ChemNet > CAS > 142184-30-3 (+)-1,2-Bis((2S,5S)-diethylphospholano)benzene(cyclooctadiene)rhodium(I) triflate
142184-30-3 (+)-1,2-Bis((2S,5S)-diethylphospholano)benzene(cyclooctadiene)rhodium(I) triflate
| product Name |
(+)-1,2-Bis((2S,5S)-diethylphospholano)benzene(cyclooctadiene)rhodium(I) triflate |
| CAS No |
142184-30-3 |
| Synonyms |
(+)-1,2-Bis[(2S,5S)-diethylphospholano)benzene(cyclooctadiene]rhodium(I) triflate; (+)-1,2-Bis((2S,5S)-2,5-diethylphospholano)benzene(1,5-cyclooctadiene)rhodium(I) trifluoromethanesulfonate |
| Molecular Formula |
C6H7BrN2 |
| Molecular Weight |
187.0372 |
| InChI |
InChI=1/C6H7BrN2/c1-4-2-6(8)9-3-5(4)7/h2-3H,1H3,(H2,8,9) |
| Molecular Structure |
|
| Density |
1.593g/cm3 |
| Boiling point |
254.2°C at 760 mmHg |
| Refractive index |
1.617 |
| Flash point |
107.5°C |
| Vapour Pressur |
0.0175mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
