ChemNet > CAS > 1422-54-4 2-Bromo-6-fluorotoluene
1422-54-4 2-Bromo-6-fluorotoluene
| product Name |
2-Bromo-6-fluorotoluene |
| CAS No |
1422-54-4 |
| Synonyms |
Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
| Molecular Formula |
C7H4ClFN2S |
| Molecular Weight |
202.6365 |
| InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| Molecular Structure |
|
| Density |
1.63g/cm3 |
| Boiling point |
294°C at 760 mmHg |
| Refractive index |
1.714 |
| Flash point |
131.6°C |
| Vapour Pressur |
0.00166mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
