ChemNet > CAS > 14282-78-1 4-methylthiophene-2-carboxylic acid
14282-78-1 4-methylthiophene-2-carboxylic acid
| product Name |
4-methylthiophene-2-carboxylic acid |
| CAS No |
14282-78-1 |
| Molecular Formula |
C6H6O2S |
| Molecular Weight |
142.1756 |
| InChI |
InChI=1/C6H6O2S/c1-4-2-5(6(7)8)9-3-4/h2-3H,1H3,(H,7,8) |
| Molecular Structure |
|
| Density |
1.319g/cm3 |
| Melting point |
122℃ |
| Boiling point |
277.2°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
121.5°C |
| Vapour Pressur |
0.0022mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
