ChemNet > CAS > 14331-56-7 4-hydrazino-2,6-dimethylpyrimidine
14331-56-7 4-hydrazino-2,6-dimethylpyrimidine
| product Name |
4-hydrazino-2,6-dimethylpyrimidine |
| CAS No |
14331-56-7 |
| Synonyms |
4-hydrazinyl-2,6-dimethylpyrimidine; (1S)-1-phenylpropan-1-ol |
| Molecular Formula |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-2-9(10)8-6-4-3-5-7-8/h3-7,9-10H,2H2,1H3/t9-/m0/s1 |
| EINECS |
202-256-0 |
| Molecular Structure |
|
| Density |
0.994g/cm3 |
| Melting point |
182℃ |
| Boiling point |
219°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
97.3°C |
| Vapour Pressur |
0.0707mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
