ChemNet > CAS > 143879-77-0 2,6-Difluoro-3-nitrobenzonitrile
143879-77-0 2,6-Difluoro-3-nitrobenzonitrile
| product Name |
2,6-Difluoro-3-nitrobenzonitrile |
| CAS No |
143879-77-0 |
| Molecular Formula |
C7H2F2N2O2 |
| Molecular Weight |
184.0998 |
| InChI |
InChI=1/C7H2F2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H |
| Molecular Structure |
|
| Density |
1.51g/cm3 |
| Boiling point |
263.7°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
113.3°C |
| Vapour Pressur |
0.0101mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
