14447-18-8 Benzyl cyanoacetate
product Name |
Benzyl cyanoacetate |
CAS No |
14447-18-8 |
Synonyms |
Cyanoacetic acid benzyl ester |
Molecular Formula |
C10H9NO2 |
Molecular Weight |
175.184 |
InChI |
InChI=1/C10H9NO2/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5H,6,8H2 |
Molecular Structure |
|
Density |
1.151g/cm3 |
Boiling point |
313.2°C at 760 mmHg |
Refractive index |
1.526 |
Flash point |
146°C |
Vapour Pressur |
0.000503mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|