ChemNet > CAS > 144693-65-2 4-Ethynylbenzoic acid sodium salt
144693-65-2 4-Ethynylbenzoic acid sodium salt
| product Name |
4-Ethynylbenzoic acid sodium salt |
| CAS No |
144693-65-2 |
| Synonyms |
(4-Carboxyphenyl)acetylene sodium salt~Sodium 4-ethynylbenzoate; sodium 4-ethynylbenzoate |
| Molecular Formula |
C9H5NaO2 |
| Molecular Weight |
168.1246 |
| InChI |
InChI=1/C9H6O2.Na/c1-2-7-3-5-8(6-4-7)9(10)11;/h1,3-6H,(H,10,11);/q;+1/p-1 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
