ChemNet > CAS > 14548-48-2 4-(4-Chlorobenzoyl)pyridine
14548-48-2 4-(4-Chlorobenzoyl)pyridine
| product Name |
4-(4-Chlorobenzoyl)pyridine |
| CAS No |
14548-48-2 |
| Synonyms |
4-Chlorophenyl 4-pyridyl ketone; 4-chlorophenyl pyridine-4-yl ketone; (4-chlorophenyl)(pyridin-4-yl)methanone |
| Molecular Formula |
C12H8ClNO |
| Molecular Weight |
217.651 |
| InChI |
InChI=1/C12H8ClNO/c13-11-3-1-9(2-4-11)12(15)10-5-7-14-8-6-10/h1-8H |
| EINECS |
238-587-2 |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Melting point |
107-110℃ |
| Boiling point |
357.3°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
169.9°C |
| Vapour Pressur |
2.75E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
