ChemNet > CAS > 1457-47-2 N-Allylrhodanine
1457-47-2 N-Allylrhodanine
| product Name |
N-Allylrhodanine |
| CAS No |
1457-47-2 |
| Molecular Formula |
C6H7NOS2 |
| Molecular Weight |
173.2559 |
| InChI |
InChI=1/C6H7NOS2/c1-2-3-7-5(8)4-10-6(7)9/h2H,1,3-4H2 |
| EINECS |
215-941-4 |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Melting point |
43-46℃ |
| Boiling point |
248.8°C at 760 mmHg |
| Refractive index |
1.651 |
| Flash point |
104.3°C |
| Vapour Pressur |
0.0238mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
