ChemNet > CAS > 1457-85-8 Ethyl oxanilate
1457-85-8 Ethyl oxanilate
| product Name |
Ethyl oxanilate |
| CAS No |
1457-85-8 |
| Synonyms |
Oxanilic acid ethyl ester; ethyl oxo(phenylamino)acetate |
| Molecular Formula |
C10H11NO3 |
| Molecular Weight |
193.1992 |
| InChI |
InChI=1/C10H11NO3/c1-2-14-10(13)9(12)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,11,12) |
| EINECS |
215-945-6 |
| Molecular Structure |
|
| Density |
1.215g/cm3 |
| Melting point |
66-70℃ |
| Refractive index |
1.561 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
