ChemNet > CAS > 1459-00-3 beta-Bromoisopropylbenzene
1459-00-3 beta-Bromoisopropylbenzene
| product Name |
beta-Bromoisopropylbenzene |
| Synonyms |
1-Bromo-2-phenylpropane; beta-Bromocumene; 2-Phenylpropyl bromide; [(2S)-1-bromopropan-2-yl]benzene; β-Bromoisopropylbenzene |
| Molecular Formula |
C9H11Br |
| Molecular Weight |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3/t8-/m1/s1 |
| CAS Registry Number |
1459-00-3 |
| EINECS |
215-948-2 |
| Molecular Structure |
|
| Density |
1.303g/cm3 |
| Boiling point |
188.5°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
85.9°C |
| Vapour Pressur |
0.825mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
