ChemNet > CAS > 1460-18-0 1,15-Pentadecanedioic acid
1460-18-0 1,15-Pentadecanedioic acid
| product Name |
1,15-Pentadecanedioic acid |
| CAS No |
1460-18-0 |
| Synonyms |
Pentadecanedioic acid |
| Molecular Formula |
C15H28O4 |
| Molecular Weight |
272.3804 |
| InChI |
InChI=1/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19) |
| Molecular Structure |
|
| Density |
1.026g/cm3 |
| Melting point |
113-114℃ |
| Boiling point |
445.8°C at 760 mmHg |
| Refractive index |
1.474 |
| Flash point |
237.5°C |
| Vapour Pressur |
3.44E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
