ChemNet > CAS > 1466-88-2 o-Nitrocinnamaldehyde
1466-88-2 o-Nitrocinnamaldehyde
| product Name |
o-Nitrocinnamaldehyde |
| CAS No |
1466-88-2 |
| Synonyms |
2-Nitrocinnamaldehyde; 3-(2-nitrophenyl)prop-2-enal; (2E)-3-(2-nitrophenyl)prop-2-enal |
| Molecular Formula |
C9H7NO3 |
| Molecular Weight |
177.1568 |
| InChI |
InChI=1/C9H7NO3/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-7H/b5-3+ |
| EINECS |
215-988-0 |
| Molecular Structure |
|
| Density |
1.269g/cm3 |
| Melting point |
125-126℃ |
| Boiling point |
348.1°C at 760 mmHg |
| Refractive index |
1.617 |
| Flash point |
178.1°C |
| Vapour Pressur |
5.15E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
