ChemNet > CAS > 14765-30-1 2-sec-butylcyclohexanone
14765-30-1 2-sec-butylcyclohexanone
| product Name |
2-sec-butylcyclohexanone |
| CAS No |
14765-30-1 |
| Synonyms |
Cyclohexanone, 2-(1-methylpropyl)-; 2-(1-Methylpropyl)cyclohexanone; 2-sec-Butylcyclohexanone; BRN 1859137; Butylcyclohexanone, O-sec-; Cyclohexanone, 2-sec-butyl-; FEMA No. 3261; NSC 21146; UNII-5WA6R1KL5J; 2-sec-Butylcyclohexan-1-one; Cyclohexanone, 2-sec-butyl-; 2-(butan-2-yl)cyclohexanone; 2-(1-Methylpropyl)-Cyclohexanone |
| Molecular Formula |
C10H18O |
| Molecular Weight |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-3-8(2)9-6-4-5-7-10(9)11/h8-9H,3-7H2,1-2H3 |
| EINECS |
238-830-2 |
| Molecular Structure |
|
| Density |
0.899g/cm3 |
| Boiling point |
213.5°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
75.8°C |
| Vapour Pressur |
0.163mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
