ChemNet > CAS > 148-87-8 3-(N-ethylanilino)propiononitrile
148-87-8 3-(N-ethylanilino)propiononitrile
| product Name |
3-(N-ethylanilino)propiononitrile |
| Synonyms |
N-(2-Cyanoethyl)-N-ethylaniline; 3-(N-Ethylanilino)propionitrile; N-ethyl-N-cyanoethylaniline; 3-[ethyl(phenyl)amino]propanenitrile; 3-Ethylanilinopropiononitrile |
| Molecular Formula |
C11H14N2 |
| Molecular Weight |
174.2423 |
| InChI |
InChI=1/C11H14N2/c1-2-13(10-6-9-12)11-7-4-3-5-8-11/h3-5,7-8H,2,6,10H2,1H3 |
| CAS Registry Number |
148-87-8 |
| EINECS |
205-728-4 |
| Molecular Structure |
|
| Density |
1.022g/cm3 |
| Boiling point |
311.9°C at 760 mmHg |
| Refractive index |
1.551 |
| Flash point |
132.8°C |
| Vapour Pressur |
0.000547mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
