ChemNet > CAS > 14804-31-0 Bromomethoxytoluene
14804-31-0 Bromomethoxytoluene
| product Name |
Bromomethoxytoluene |
| CAS No |
14804-31-0 |
| Synonyms |
5-Bromo-2-methoxytoluene; 4-Bromo-2-methylanisole; 4-bromo-1-methoxy-2-methylbenzene |
| Molecular Formula |
C8H9BrO |
| Molecular Weight |
201.0605 |
| InChI |
InChI=1/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.378g/cm3 |
| Melting point |
66-69℃ |
| Boiling point |
226.1°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
102.3°C |
| Vapour Pressur |
0.125mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
