14804-31-0 Bromomethoxytoluene
product Name |
Bromomethoxytoluene |
CAS No |
14804-31-0 |
Synonyms |
5-Bromo-2-methoxytoluene; 4-Bromo-2-methylanisole; 4-bromo-1-methoxy-2-methylbenzene |
Molecular Formula |
C8H9BrO |
Molecular Weight |
201.0605 |
InChI |
InChI=1/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3 |
Molecular Structure |
|
Density |
1.378g/cm3 |
Melting point |
66-69℃ |
Boiling point |
226.1°C at 760 mmHg |
Refractive index |
1.535 |
Flash point |
102.3°C |
Vapour Pressur |
0.125mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|