ChemNet > CAS > 1481-02-3 1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one
1481-02-3 1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one
| product Name |
1-Methyl-3-trifluoromethyl-2-pyrazolin-5-one |
| CAS No |
1481-02-3 |
| Synonyms |
1-Methyl-3-trifluormethyl-2-pyrazolin-5-one; 1-(4-fluoro-2-hydroxy-phenyl)ethanone |
| Molecular Formula |
C8H7FO2 |
| Molecular Weight |
154.1384 |
| InChI |
InChI=1/C8H7FO2/c1-5(10)7-3-2-6(9)4-8(7)11/h2-4,11H,1H3 |
| Molecular Structure |
|
| Density |
1.247g/cm3 |
| Melting point |
178-180℃ |
| Boiling point |
237.495°C at 760 mmHg |
| Refractive index |
1.53 |
| Flash point |
97.434°C |
| Vapour Pressur |
0.029mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
