ChemNet > CAS > 1483-72-3 Diphenyliodonium chloride
1483-72-3 Diphenyliodonium chloride
| product Name |
Diphenyliodonium chloride |
| CAS No |
1483-72-3 |
| Synonyms |
Iodonium, diphenyl-, chloride (1:1); AI3-17092; NSC 134275; Iodonium, diphenyl-, chloride |
| Molecular Formula |
C12H10I |
| Molecular Weight |
281.11227 |
| InChI |
InChI=1/C12H10I/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H/q-1 |
| EINECS |
216-049-8 |
| Molecular Structure |
|
| Melting point |
227-235℃ |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S37/39:Wear suitable gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
