ChemNet > CAS > 14852-31-4 2-Hexadecanol
14852-31-4 2-Hexadecanol
| product Name |
2-Hexadecanol |
| CAS No |
14852-31-4 |
| Synonyms |
Hexadecan-2-ol; AI3-35278; NSC 87605 |
| Molecular Formula |
C16H34O |
| Molecular Weight |
242.4406 |
| InChI |
InChI=1/C16H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17/h16-17H,3-15H2,1-2H3 |
| EINECS |
238-917-5 |
| Molecular Structure |
|
| Density |
0.834g/cm3 |
| Melting point |
43-48℃ |
| Boiling point |
314°C at 760 mmHg |
| Refractive index |
1.447 |
| Flash point |
111.3°C |
| Vapour Pressur |
4.14E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
