ChemNet > CAS > 1488-42-2 Diphenyliodoniumcarboxylatemonohydrate
1488-42-2 Diphenyliodoniumcarboxylatemonohydrate
| product Name |
Diphenyliodoniumcarboxylatemonohydrate |
| CAS No |
1488-42-2 |
| Synonyms |
2-(Phenyliodonio)benzoate; 216-070-2 |
| Molecular Formula |
C13H10IO2 |
| Molecular Weight |
325.12177 |
| InChI |
InChI=1/C13H10IO2/c15-13(16)11-8-4-5-9-12(11)14-10-6-2-1-3-7-10/h1-9H,(H,15,16)/q-1 |
| EINECS |
216-070-2 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
