ChemNet > CAS > 14883-87-5 DL-3,4-Dihydroxymandelic acid
14883-87-5 DL-3,4-Dihydroxymandelic acid
| product Name |
DL-3,4-Dihydroxymandelic acid |
| CAS No |
14883-87-5 |
| Synonyms |
(1)-3,4-Dihydroxyphenylglycolic acid; (3,4-dihydroxyphenyl)(hydroxy)acetic acid; (2S)-(3,4-dihydroxyphenyl)(hydroxy)ethanoate; (2R)-(3,4-dihydroxyphenyl)(hydroxy)ethanoate |
| Molecular Formula |
C8H7O5 |
| Molecular Weight |
183.1387 |
| InChI |
InChI=1/C8H8O5/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,9-11H,(H,12,13)/p-1/t7-/m1/s1 |
| EINECS |
238-956-8 |
| Molecular Structure |
|
| Melting point |
133-137℃ |
| Boiling point |
487.5°C at 760 mmHg |
| Flash point |
262.7°C |
| Vapour Pressur |
2.57E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
