ChemNet > CAS > 14979-39-6 4-Methyl-3-heptanol
14979-39-6 4-Methyl-3-heptanol
| product Name |
4-Methyl-3-heptanol |
| CAS No |
14979-39-6 |
| Synonyms |
4-Methyl-3-heptanol,mixture of isomers; Ethyl 2-pentyl carbinol; 4-methylheptan-3-ol; (3R,4S)-4-methylheptan-3-ol; (3S,4S)-4-methylheptan-3-ol; (3R,4R)-4-methylheptan-3-ol; (3S,4R)-4-methylheptan-3-ol |
| Molecular Formula |
C8H18O |
| Molecular Weight |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-4-6-7(3)8(9)5-2/h7-9H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| EINECS |
239-058-9 |
| Molecular Structure |
|
| Density |
0.819g/cm3 |
| Boiling point |
158.5°C at 760 mmHg |
| Refractive index |
1.424 |
| Flash point |
54.4°C |
| Vapour Pressur |
0.927mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
|
| MSDS |
Material Safety Data Sheet
|
|
