ChemNet > CAS > 150-77-6 N,N,N',N'-Tetraethylethylenediamine
150-77-6 N,N,N',N'-Tetraethylethylenediamine
| product Name |
N,N,N',N'-Tetraethylethylenediamine |
| CAS No |
150-77-6 |
| Synonyms |
1,2-Bis(diethylamino)ethane; N,N,N',N'-tetraethylethane-1,2-diamine; N,N,N',N'-tetraethylethane-1,2-diaminium |
| Molecular Formula |
C10H26N2 |
| Molecular Weight |
174.3257 |
| InChI |
InChI=1/C10H24N2/c1-5-11(6-2)9-10-12(7-3)8-4/h5-10H2,1-4H3/p+2 |
| EINECS |
205-770-3 |
| Molecular Structure |
|
| Boiling point |
190.5°C at 760 mmHg |
| Flash point |
58.9°C |
| Vapour Pressur |
0.54mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
