ChemNet > CAS > 150-83-4 3-hydroxybutyric acid, sodium salt
150-83-4 3-hydroxybutyric acid, sodium salt
| product Name |
3-hydroxybutyric acid, sodium salt |
| Synonyms |
3-Hydroxybutyric acid sodium salt; DL-beta-Hydroxybutyric acid sodium salt; Sodium 3-hydroxybutyrate; sodium 3-hydroxybutanoate; butanoic acid, 3-hydroxy-, sodium salt (1:1); Dl-3-Hydroxybutyric Acid Sodium Salt |
| Molecular Formula |
C4H8NaO3 |
| Molecular Weight |
127.0943 |
| InChI |
InChI=1/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7); |
| CAS Registry Number |
150-83-4 |
| EINECS |
205-774-5 |
| Molecular Structure |
|
| Melting point |
165-167℃ |
| Boiling point |
269.2°C at 760 mmHg |
| Flash point |
121°C |
| Vapour Pressur |
0.000979mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
