ChemNet > CAS > 1502-22-3 2-(1-Cyclohexenyl)cyclohexanone
1502-22-3 2-(1-Cyclohexenyl)cyclohexanone
| product Name |
2-(1-Cyclohexenyl)cyclohexanone |
| CAS No |
1502-22-3 |
| Synonyms |
2-(1-cyclohexen-1-yl)-Cyclohexanone |
| Molecular Formula |
C12H18O |
| Molecular Weight |
178.2707 |
| InChI |
InChI=1/C12H18O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h6,11H,1-5,7-9H2/t11-/m1/s1 |
| EINECS |
216-120-3 |
| Molecular Structure |
|
| Density |
1.022g/cm3 |
| Boiling point |
281.9°C at 760 mmHg |
| Refractive index |
1.521 |
| Flash point |
116.1°C |
| Vapour Pressur |
0.00346mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
