ChemNet > CAS > 15088-78-5 Phenylacetyl Disulphide
15088-78-5 Phenylacetyl Disulphide
| product Name |
Phenylacetyl Disulphide |
| CAS No |
15088-78-5 |
| Synonyms |
Phenylacetyl Disulfide; Bis(phenylacetyl) disulphide; PADS; Phenylacetyldisulfide; dibenzyldithioperoxyanhydride |
| Molecular Formula |
C16H14O2S2 |
| Molecular Weight |
302.4112 |
| InChI |
InChI=1/C16H14O2S2/c17-15(11-13-7-3-1-4-8-13)19-20-16(18)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| Molecular Structure |
|
| Density |
1.269g/cm3 |
| Melting point |
59-63℃ |
| Boiling point |
481.1°C at 760 mmHg |
| Refractive index |
1.638 |
| Flash point |
210.1°C |
| Vapour Pressur |
2.05E-09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
