ChemNet > CAS > 1513-60-6 ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate
1513-60-6 ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate
| product Name |
ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate |
| CAS No |
1513-60-6 |
| Synonyms |
Ethyl-4,4,4-trifluoro-3-(trifluoromethyl)-crotonate; 4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid ethyl ester; 1-ethynyl-3,5-difluorobenzene |
| Molecular Formula |
C8H4F2 |
| Molecular Weight |
138.1142 |
| InChI |
InChI=1/C8H4F2/c1-2-6-3-7(9)5-8(10)4-6/h1,3-5H |
| Molecular Structure |
|
| Density |
1.17g/cm3 |
| Boiling point |
147.1°C at 760 mmHg |
| Refractive index |
1.492 |
| Flash point |
32°C |
| Vapour Pressur |
5.69mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
