ChemNet > CAS > 1515-75-9 methyl 1,3-butadiene-1-carboxylate mixt. of cis/trans
1515-75-9 methyl 1,3-butadiene-1-carboxylate mixt. of cis/trans
| product Name |
methyl 1,3-butadiene-1-carboxylate mixt. of cis/trans |
| CAS No |
1515-75-9 |
| Synonyms |
2,4-pentadienoic acid methyl ester; Methyl 2,4-pentadienoate; methyl penta-2,4-dienoate; methyl (2E)-penta-2,4-dienoate |
| Molecular Formula |
C6H8O2 |
| Molecular Weight |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-3-4-5-6(7)8-2/h3-5H,1H2,2H3/b5-4+ |
| EINECS |
216-158-0 |
| Molecular Structure |
|
| Density |
0.936g/cm3 |
| Boiling point |
135.2°C at 760 mmHg |
| Refractive index |
1.437 |
| Flash point |
46.4°C |
| Vapour Pressur |
7.8mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
