ChemNet > CAS > 1517-66-4 (+)-3-Methyl-2-butanol
1517-66-4 (+)-3-Methyl-2-butanol
| product Name |
(+)-3-Methyl-2-butanol |
| CAS No |
1517-66-4 |
| Synonyms |
(S)-(+)-3-Methyl-2-butanol; (S)-(+)-Isopropyl methyl carbinol; 3-methylbutan-2-ol; (2S)-3-methylbutan-2-ol |
| Molecular Formula |
C5H12O |
| Molecular Weight |
88.1482 |
| InChI |
InChI=1/C5H12O/c1-4(2)5(3)6/h4-6H,1-3H3/t5-/m0/s1 |
| EINECS |
209-950-2 |
| Molecular Structure |
|
| Density |
0.806g/cm3 |
| Boiling point |
113.6°C at 760 mmHg |
| Refractive index |
1.402 |
| Flash point |
26.7°C |
| Vapour Pressur |
10.6mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R20:Harmful by inhalation.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
