ChemNet > CAS > 151982-51-3 4-Bromo-2-fluorobenzoyl chloride
151982-51-3 4-Bromo-2-fluorobenzoyl chloride
| product Name |
4-Bromo-2-fluorobenzoyl chloride |
| CAS No |
151982-51-3 |
| Synonyms |
2-Fluoro-4-Bromobenzoyl Chloride; 2-fluoro-4-broMobenzyl chloride |
| Molecular Formula |
C7H3BrClFO |
| Molecular Weight |
237.4535 |
| InChI |
InChI=1/C7H3BrClFO/c8-4-1-2-5(7(9)11)6(10)3-4/h1-3H |
| Molecular Structure |
|
| Density |
1.742g/cm3 |
| Boiling point |
236.9°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
97.1°C |
| Vapour Pressur |
0.0462mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
