ChemNet > CAS > 15219-34-8 Oxalyl bromide
15219-34-8 Oxalyl bromide
| product Name |
Oxalyl bromide |
| CAS No |
15219-34-8 |
| Synonyms |
Ethanedioyl dibromide; Ethanedioyl bromide; NSC 96957; Oxalyl bromide |
| Molecular Formula |
C2Br2O2 |
| Molecular Weight |
215.8282 |
| InChI |
InChI=1/C2Br2O2/c3-1(5)2(4)6 |
| EINECS |
239-271-7 |
| Molecular Structure |
|
| Density |
2.627g/cm3 |
| Melting point |
-19℃ |
| Boiling point |
118.3°C at 760 mmHg |
| Refractive index |
1.567 |
| Flash point |
109.8°C |
| Vapour Pressur |
16.8mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
