ChemNet > CAS > 1527-61-3 N1-(4-isopropylphenyl)-2-chloroacetamide
1527-61-3 N1-(4-isopropylphenyl)-2-chloroacetamide
| product Name |
N1-(4-isopropylphenyl)-2-chloroacetamide |
| CAS No |
1527-61-3 |
| Synonyms |
2-chloro-N-[4-(propan-2-yl)phenyl]acetamide |
| Molecular Formula |
C11H14ClNO |
| Molecular Weight |
211.688 |
| InChI |
InChI=1/C11H14ClNO/c1-8(2)9-3-5-10(6-4-9)13-11(14)7-12/h3-6,8H,7H2,1-2H3,(H,13,14) |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Melting point |
132℃ |
| Boiling point |
356°C at 760 mmHg |
| Refractive index |
1.56 |
| Flash point |
169.1°C |
| Vapour Pressur |
3.01E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
