1530-04-7 1,1-Diphenylhexane
product Name |
1,1-Diphenylhexane |
CAS No |
1530-04-7 |
Synonyms |
1,1'-hexane-1,1-diyldibenzene |
Molecular Formula |
C18H22 |
Molecular Weight |
238.3673 |
InChI |
InChI=1/C18H22/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h4-5,7-14,18H,2-3,6,15H2,1H3 |
Molecular Structure |
|
Density |
0.945g/cm3 |
Boiling point |
331.4°C at 760 mmHg |
Refractive index |
1.536 |
Flash point |
162.4°C |
Vapour Pressur |
0.000301mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|