ChemNet > CAS > 1530-04-7 1,1-Diphenylhexane
1530-04-7 1,1-Diphenylhexane
| product Name |
1,1-Diphenylhexane |
| CAS No |
1530-04-7 |
| Synonyms |
1,1'-hexane-1,1-diyldibenzene |
| Molecular Formula |
C18H22 |
| Molecular Weight |
238.3673 |
| InChI |
InChI=1/C18H22/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h4-5,7-14,18H,2-3,6,15H2,1H3 |
| Molecular Structure |
|
| Density |
0.945g/cm3 |
| Boiling point |
331.4°C at 760 mmHg |
| Refractive index |
1.536 |
| Flash point |
162.4°C |
| Vapour Pressur |
0.000301mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
