ChemNet > CAS > 15311-09-8 2,5-Bis(4-pyridyl)-1,3,4-thiadiazole
15311-09-8 2,5-Bis(4-pyridyl)-1,3,4-thiadiazole
| product Name |
2,5-Bis(4-pyridyl)-1,3,4-thiadiazole |
| CAS No |
15311-09-8;54010-21-8 |
| Synonyms |
4,4'-(2,5-dihydro-1,3,4-thiadiazole-2,5-diyl)dipyridine; Pyridine, 4,4'-(1,3,4-thiadiazole-2,5-diyl)di-; 1,3,4-Thiazole, 2,5-bis(4-piridinyl)-; 2,5-Bis(4-piridinyl)-1,3,4-thiadiazole; 4,4'-(1,3,4-Thiadiazole-2,5-diyl)dipyridine; 4-27-00-09589 (Beilstein Handbook Reference); BRN 0198070; NSC 34795 |
| Molecular Formula |
C12H8N4S |
| Molecular Weight |
240.2837 |
| InChI |
InChI=1/C12H8N4S/c1-5-13-6-2-9(1)11-15-16-12(17-11)10-3-7-14-8-4-10/h1-8H |
| EINECS |
239-353-2 |
| Molecular Structure |
|
| Density |
1.317g/cm3 |
| Melting point |
237-244℃ |
| Boiling point |
475.9°C at 760 mmHg |
| Refractive index |
1.645 |
| Flash point |
238.6°C |
| Vapour Pressur |
9.14E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
