ChemNet > CAS > 153195-01-8 (2-amino-5-ethyl-3-thienyl)(4-methoxyphenyl)methanone
153195-01-8 (2-amino-5-ethyl-3-thienyl)(4-methoxyphenyl)methanone
| product Name |
(2-amino-5-ethyl-3-thienyl)(4-methoxyphenyl)methanone |
| CAS No |
153195-01-8 |
| Synonyms |
(2-amino-5-ethylthiophen-3-yl)(4-methoxyphenyl)methanone |
| Molecular Formula |
C14H15NO2S |
| Molecular Weight |
261.3394 |
| InChI |
InChI=1/C14H15NO2S/c1-3-11-8-12(14(15)18-11)13(16)9-4-6-10(17-2)7-5-9/h4-8H,3,15H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.209g/cm3 |
| Melting point |
100℃ |
| Boiling point |
458.9°C at 760 mmHg |
| Refractive index |
1.609 |
| Flash point |
231.4°C |
| Vapour Pressur |
1.32E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
