ChemNet > CAS > 1536-23-8 2,3,4,5,6-Pentafluorobenzophenone
1536-23-8 2,3,4,5,6-Pentafluorobenzophenone
| product Name |
2,3,4,5,6-Pentafluorobenzophenone |
| CAS No |
1536-23-8 |
| Synonyms |
Pentafluorophenyl phenyl ketone |
| Molecular Formula |
C13H5F5O |
| Molecular Weight |
272.17 |
| InChI |
InChI=1/C13H5F5O/c14-8-7(9(15)11(17)12(18)10(8)16)13(19)6-4-2-1-3-5-6/h1-5H |
| EINECS |
216-258-4 |
| Molecular Structure |
|
| Melting point |
35-39℃ |
| Boiling point |
93℃(0.2 torr) |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
