1540-29-0 Ethyl 2-acetylhexanoate
product Name |
Ethyl 2-acetylhexanoate |
CAS No |
1540-29-0 |
Synonyms |
2-n-Butylacetoacetic acid ethyl ester; Ethyl 2-n-butylacetoacetate |
Molecular Formula |
C10H18O3 |
Molecular Weight |
186.2481 |
InChI |
InChI=1/C10H18O3/c1-4-6-7-9(8(3)11)10(12)13-5-2/h9H,4-7H2,1-3H3 |
EINECS |
216-271-5 |
Molecular Structure |
|
Density |
0.957g/cm3 |
Boiling point |
221.5°C at 760 mmHg |
Refractive index |
1.428 |
Flash point |
89.1°C |
Vapour Pressur |
0.107mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|