ChemNet > CAS > 1540-29-0 Ethyl 2-acetylhexanoate
1540-29-0 Ethyl 2-acetylhexanoate
| product Name |
Ethyl 2-acetylhexanoate |
| CAS No |
1540-29-0 |
| Synonyms |
2-n-Butylacetoacetic acid ethyl ester; Ethyl 2-n-butylacetoacetate |
| Molecular Formula |
C10H18O3 |
| Molecular Weight |
186.2481 |
| InChI |
InChI=1/C10H18O3/c1-4-6-7-9(8(3)11)10(12)13-5-2/h9H,4-7H2,1-3H3 |
| EINECS |
216-271-5 |
| Molecular Structure |
|
| Density |
0.957g/cm3 |
| Boiling point |
221.5°C at 760 mmHg |
| Refractive index |
1.428 |
| Flash point |
89.1°C |
| Vapour Pressur |
0.107mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
