ChemNet > CAS > 1540-36-9 3-n-Butyl-2,4-pentanedione
1540-36-9 3-n-Butyl-2,4-pentanedione
| product Name |
3-n-Butyl-2,4-pentanedione |
| CAS No |
1540-36-9 |
| Synonyms |
3-Acetyl-2-heptanone; 3-butylpentane-2,4-dione; (3E)-3-(1-hydroxyethylidene)heptan-2-one |
| Molecular Formula |
C9H16O2 |
| Molecular Weight |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-4-5-6-9(7(2)10)8(3)11/h10H,4-6H2,1-3H3/b9-7+ |
| EINECS |
216-274-1 |
| Molecular Structure |
|
| Density |
0.947g/cm3 |
| Boiling point |
255.1°C at 760 mmHg |
| Refractive index |
1.458 |
| Flash point |
105.4°C |
| Vapour Pressur |
0.00253mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
