ChemNet > CAS > 15400-53-0 2-Amino-5-carboethoxy-4-hydroxypyrimidine
15400-53-0 2-Amino-5-carboethoxy-4-hydroxypyrimidine
| product Name |
2-Amino-5-carboethoxy-4-hydroxypyrimidine |
| CAS No |
15400-53-0 |
| Synonyms |
2-Amino-5-ethoxycarbonyl-4-hydroxypyrimidine; 2-Amino-4-hydroxypyrimidine-5-carboxylic acid ethyl ester; Ethyl 2-amino-4-hydroxypyrimidine-5-carboxylate; ethyl 2-amino-6-oxo-1,6-dihydropyrimidine-5-carboxylate; Ethyl2-amino-4-hydroxypyrimidine-5-carboxylate |
| Molecular Formula |
C7H9N3O3 |
| Molecular Weight |
183.1647 |
| InChI |
InChI=1/C7H9N3O3/c1-2-13-6(12)4-3-9-7(8)10-5(4)11/h3H,2H2,1H3,(H3,8,9,10,11) |
| EINECS |
239-418-5 |
| Molecular Structure |
|
| Density |
1.48g/cm3 |
| Boiling point |
379°C at 760 mmHg |
| Refractive index |
1.618 |
| Flash point |
183°C |
| Vapour Pressur |
2.78E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
