ChemNet > CAS > 154607-01-9 4-Bromo-2-chlorobenzonitrile
154607-01-9 4-Bromo-2-chlorobenzonitrile
| product Name |
4-Bromo-2-chlorobenzonitrile |
| CAS No |
154607-01-9 |
| Synonyms |
2-Chloro-4-Bromobenzonitrile |
| Molecular Formula |
C7H3BrClN |
| Molecular Weight |
216.4624 |
| InChI |
InChI=1/C7H3BrClN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| Molecular Structure |
|
| Density |
1.74g/cm3 |
| Boiling point |
279.8°C at 760 mmHg |
| Refractive index |
1.623 |
| Flash point |
123°C |
| Vapour Pressur |
0.00393mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
