ChemNet > CAS > 1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
| product Name |
4-amino-2,3,5,6-tetrafluorobenzamide |
| CAS No |
1548-74-9 |
| Molecular Formula |
C7H4F4N2O |
| Molecular Weight |
208.1131 |
| InChI |
InChI=1/C7H4F4N2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H2,13,14) |
| EINECS |
216-285-1 |
| Molecular Structure |
|
| Density |
1.635g/cm3 |
| Melting point |
185-186℃ |
| Boiling point |
148.4°C at 760 mmHg |
| Refractive index |
1.531 |
| Flash point |
43.5°C |
| Vapour Pressur |
4.23mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
