ChemNet > CAS > 15499-27-1 4-n-Butylchlorobenzene
15499-27-1 4-n-Butylchlorobenzene
| product Name |
4-n-Butylchlorobenzene |
| CAS No |
15499-27-1 |
| Synonyms |
1-n-Butyl-4-chlorobenzene; 4-Chloro-n-butylbenzene; 1-butyl-4-chlorobenzene |
| Molecular Formula |
C10H13Cl |
| Molecular Weight |
168.6632 |
| InChI |
InChI=1/C10H13Cl/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3 |
| Molecular Structure |
|
| Density |
1.008g/cm3 |
| Boiling point |
216.6°C at 760 mmHg |
| Refractive index |
1.509 |
| Flash point |
88°C |
| Vapour Pressur |
0.204mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
