ChemNet > CAS > 1551-44-6 cyclohexyl butyrate
1551-44-6 cyclohexyl butyrate
| product Name |
cyclohexyl butyrate |
| CAS No |
1551-44-6 |
| Synonyms |
Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
| Molecular Formula |
C10H18O2 |
| Molecular Weight |
170.2487 |
| InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
| EINECS |
216-290-9 |
| Molecular Structure |
|
| Density |
0.94g/cm3 |
| Boiling point |
214.9°C at 760 mmHg |
| Refractive index |
1.449 |
| Flash point |
78°C |
| Vapour Pressur |
0.152mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
