1551-44-6 cyclohexyl butyrate
product Name |
cyclohexyl butyrate |
CAS No |
1551-44-6 |
Synonyms |
Cyclohexyl butyrate,(Butyric acid cyclohexyl ester); Butyric acid cyclohexyl ester; cyclohexyl butanoate |
Molecular Formula |
C10H18O2 |
Molecular Weight |
170.2487 |
InChI |
InChI=1/C10H18O2/c1-2-6-10(11)12-9-7-4-3-5-8-9/h9H,2-8H2,1H3 |
EINECS |
216-290-9 |
Molecular Structure |
|
Density |
0.94g/cm3 |
Boiling point |
214.9°C at 760 mmHg |
Refractive index |
1.449 |
Flash point |
78°C |
Vapour Pressur |
0.152mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|