ChemNet > CAS > 15519-28-5 Cesium bicarbonate
15519-28-5 Cesium bicarbonate
| product Name |
Cesium bicarbonate |
| CAS No |
15519-28-5 |
| Synonyms |
caesium hydrogencarbonate; caesium hydrogen carbonate |
| Molecular Formula |
CHCsO3 |
| Molecular Weight |
193.9223 |
| InChI |
InChI=1/CH2O3.Cs/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| EINECS |
239-554-5 |
| Molecular Structure |
|
| Boiling point |
333.6°C at 760 mmHg |
| Flash point |
169.8°C |
| Vapour Pressur |
2.58E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
