ChemNet > CAS > 1562-94-3 4,4'-Azoxyanisole
1562-94-3 4,4'-Azoxyanisole
| product Name |
4,4'-Azoxyanisole |
| CAS No |
1562-94-3 |
| Synonyms |
4,4-Azoxydianisole; 4,4-Dimethoxyazoxybenzene; 1-methoxy-4-((4-methoxyphenyl)-NON-azoxy)benzene; 4,4?Azoxyanisole; 1-methoxy-4-[(Z)-(4-methoxyphenyl)-NNO-azoxy]benzene; 1-methoxy-4-[(E)-(4-methoxyphenyl)-NNO-azoxy]benzene; (4-methoxyphenyl)-(4-methoxyphenyl)imino-oxido-ammonium |
| Molecular Formula |
C14H14N2O3 |
| Molecular Weight |
258.2726 |
| InChI |
InChI=1/C14H14N2O3/c1-18-13-7-3-11(4-8-13)15-16(17)12-5-9-14(19-2)10-6-12/h3-10H,1-2H3 |
| EINECS |
216-348-3 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Melting point |
132-121℃ |
| Boiling point |
417.9°C at 760 mmHg |
| Refractive index |
1.555 |
| Flash point |
206.6°C |
| Vapour Pressur |
8.26E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
