ChemNet > CAS > 1565-81-7 3-Decanol
1565-81-7 3-Decanol
| product Name |
3-Decanol |
| CAS No |
1565-81-7 |
| Synonyms |
Ethyl n-heptyl carbinol; decan-3-ol |
| Molecular Formula |
C10H22O |
| Molecular Weight |
158.2811 |
| InChI |
InChI=1/C10H22O/c1-3-5-6-7-8-9-10(11)4-2/h10-11H,3-9H2,1-2H3 |
| Molecular Structure |
|
| Density |
0.826g/cm3 |
| Boiling point |
213.4°C at 760 mmHg |
| Refractive index |
1.434 |
| Flash point |
87.1°C |
| Vapour Pressur |
0.0365mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
