ChemNet > CAS > 1569-50-2 3-Penten-2-ol, mixture of cis/trans (>90% trans)
1569-50-2 3-Penten-2-ol, mixture of cis/trans (>90% trans)
| product Name |
3-Penten-2-ol, mixture of cis/trans (>90% trans) |
| CAS No |
1569-50-2 |
| Synonyms |
3-penten-2-ol (cis+trans); 3-Penten-2-ol; pent-3-en-2-ol; (2R,3E)-pent-3-en-2-ol; (2S,3E)-pent-3-en-2-ol |
| Molecular Formula |
C5H10O |
| Molecular Weight |
86.1323 |
| InChI |
InChI=1/C5H10O/c1-3-4-5(2)6/h3-6H,1-2H3/b4-3+/t5-/m0/s1 |
| EINECS |
216-376-6 |
| Molecular Structure |
|
| Density |
0.839g/cm3 |
| Boiling point |
118.5°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
27.8°C |
| Vapour Pressur |
8.18mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
|
| MSDS |
Material Safety Data Sheet
|
|
