ChemNet > CAS > 1569-60-4 6-methyl-5-hepten-2-ol
1569-60-4 6-methyl-5-hepten-2-ol
| product Name |
6-methyl-5-hepten-2-ol |
| Synonyms |
(+/-)-6-Methyl-5-hepten-2-ol; 6-methylhept-5-en-2-ol; (2R)-6-methylhept-5-en-2-ol |
| Molecular Formula |
C8H16O |
| Molecular Weight |
128.212 |
| InChI |
InChI=1/C8H16O/c1-7(2)5-4-6-8(3)9/h5,8-9H,4,6H2,1-3H3/t8-/m1/s1 |
| CAS Registry Number |
1569-60-4 |
| EINECS |
216-377-1 |
| Molecular Structure |
|
| Density |
0.844g/cm3 |
| Boiling point |
175°C at 760 mmHg |
| Refractive index |
1.446 |
| Flash point |
67.8°C |
| Vapour Pressur |
0.362mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
