1569-60-4 6-methyl-5-hepten-2-ol
product Name |
6-methyl-5-hepten-2-ol |
CAS No |
1569-60-4 |
Synonyms |
(+/-)-6-Methyl-5-hepten-2-ol; 6-methylhept-5-en-2-ol; (2R)-6-methylhept-5-en-2-ol |
Molecular Formula |
C8H16O |
Molecular Weight |
128.212 |
InChI |
InChI=1/C8H16O/c1-7(2)5-4-6-8(3)9/h5,8-9H,4,6H2,1-3H3/t8-/m1/s1 |
EINECS |
216-377-1 |
Molecular Structure |
|
Density |
0.844g/cm3 |
Boiling point |
175°C at 760 mmHg |
Refractive index |
1.446 |
Flash point |
67.8°C |
Vapour Pressur |
0.362mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|